C21H22N4O4 — CID 172515954
N-hydroxy-4-[4-[(7-methoxy-1,8-naphthyridin-4-yl)amino]phenyl]oxane-4-carboxamide (PubChem CID 172515954) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-hydroxy-4-[4-[(7-methoxy-1,8-naphthyridin-4-yl)amino]phenyl]oxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[(7-methoxy-1,8-naphthyridin-4-yl)amino]phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 172515954 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-hydroxy-4-[4-[(7-methoxy-1,8-naphthyridin-4-yl)amino]phenyl]oxane-4-carboxamide |
| SMILES | COc1ccc2c(Nc3ccc(C4(C(=O)NO)CCOCC4)cc3)ccnc2n1 |
| InChI | InChI=1S/C21H22N4O4/c1-28-18-7-6-16-17(8-11-22-19(16)24-18)23-15-4-2-14(3-5-15)21(20(26)25-27)9-12-29-13-10-21/h2-8,11,27H,9-10,12-13H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | ZPBBTWMTHNNSEO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|