C15H11F2N3O3S — CID 170349620
5-[2,6-difluoro-4-[(sulfinoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine (PubChem CID 170349620) has the molecular formula C15H11F2N3O3S and a molecular weight of 351.33 g/mol. Its IUPAC name is 5-[2,6-difluoro-4-[(sulfinoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine.
| Compound Name | 5-[2,6-difluoro-4-[(sulfinoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 170349620 |
| Molecular Formula | C15H11F2N3O3S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 5-[2,6-difluoro-4-[(sulfinoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine |
| SMILES | O=c1ccc2c(-c3c(F)cc(CNS(=O)O)cc3F)ccnc2[nH]1 |
| InChI | InChI=1S/C15H11F2N3O3S/c16-11-5-8(7-19-24(22)23)6-12(17)14(11)9-3-4-18-15-10(9)1-2-13(21)20-15/h1-6,19H,7H2,(H,22,23)(H,18,20,21) |
| InChIKey | YLOMHIFNOPZANS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|