C15H14ClN3O — CID 164563738
5-[4-(aminomethyl)phenyl]-1H-1,8-naphthyridin-2-one;hydrochloride (PubChem CID 164563738) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is 5-[4-(aminomethyl)phenyl]-1H-1,8-naphthyridin-2-one;hydrochloride.
| Compound Name | 5-[4-(aminomethyl)phenyl]-1H-1,8-naphthyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 164563738 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 5-[4-(aminomethyl)phenyl]-1H-1,8-naphthyridin-2-one;hydrochloride |
| SMILES | Cl.NCc1ccc(-c2ccnc3[nH]c(=O)ccc23)cc1 |
| InChI | InChI=1S/C15H13N3O.ClH/c16-9-10-1-3-11(4-2-10)12-7-8-17-15-13(12)5-6-14(19)18-15;/h1-8H,9,16H2,(H,17,18,19);1H |
| InChIKey | LZYHNOBFDPRQNF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |