C17H17ClN3O3S- — CID 170349644
5-[4-[(1S)-1-[methyl(sulfinato)amino]ethyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride (PubChem CID 170349644) has the molecular formula C17H17ClN3O3S- and a molecular weight of 378.86 g/mol. Its IUPAC name is 5-[4-[(1S)-1-[methyl(sulfinato)amino]ethyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride.
| Compound Name | 5-[4-[(1S)-1-[methyl(sulfinato)amino]ethyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 170349644 |
| Molecular Formula | C17H17ClN3O3S- |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-[4-[(1S)-1-[methyl(sulfinato)amino]ethyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride |
| SMILES | C[C@@H](c1ccc(-c2ccnc3[nH]c(=O)ccc23)cc1)N(C)S(=O)[O-].Cl |
| InChI | InChI=1S/C17H17N3O3S.ClH/c1-11(20(2)24(22)23)12-3-5-13(6-4-12)14-9-10-18-17-15(14)7-8-16(21)19-17;/h3-11H,1-2H3,(H,22,23)(H,18,19,21);1H/p-1/t11-;/m0./s1 |
| InChIKey | QLTCKJZDCKYKHW-MERQFXBCSA-M |
| XLogP | 2.80 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|