C17H19Cl2N4O3S- — CID 170349583
5-[3-[2-[methyl(sulfinato)amino]ethyl]anilino]-2-oxo-1H-1,8-naphthyridine;dihydrochloride (PubChem CID 170349583) has the molecular formula C17H19Cl2N4O3S- and a molecular weight of 430.34 g/mol. Its IUPAC name is 5-[3-[2-[methyl(sulfinato)amino]ethyl]anilino]-2-oxo-1H-1,8-naphthyridine;dihydrochloride.
| Compound Name | 5-[3-[2-[methyl(sulfinato)amino]ethyl]anilino]-2-oxo-1H-1,8-naphthyridine;dihydrochloride |
|---|---|
| PubChem CID | 170349583 |
| Molecular Formula | C17H19Cl2N4O3S- |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 5-[3-[2-[methyl(sulfinato)amino]ethyl]anilino]-2-oxo-1H-1,8-naphthyridine;dihydrochloride |
| SMILES | CN(CCc1cccc(Nc2ccnc3[nH]c(=O)ccc23)c1)S(=O)[O-].Cl.Cl |
| InChI | InChI=1S/C17H18N4O3S.2ClH/c1-21(25(23)24)10-8-12-3-2-4-13(11-12)19-15-7-9-18-17-14(15)5-6-16(22)20-17;;/h2-7,9,11H,8,10H2,1H3,(H,23,24)(H2,18,19,20,22);2*1H/p-1 |
| InChIKey | RQFVTEIGGMAMAU-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|