C16H10ClN3O2 — CID 58564245
9-(3-chloroanilino)-5H-furo[3,2-c][1,8]naphthyridin-4-one (PubChem CID 58564245) has the molecular formula C16H10ClN3O2 and a molecular weight of 311.73 g/mol. Its IUPAC name is 9-(3-chloroanilino)-5H-furo[3,2-c][1,8]naphthyridin-4-one.
| Compound Name | 9-(3-chloroanilino)-5H-furo[3,2-c][1,8]naphthyridin-4-one |
|---|---|
| PubChem CID | 58564245 |
| Molecular Formula | C16H10ClN3O2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 9-(3-chloroanilino)-5H-furo[3,2-c][1,8]naphthyridin-4-one |
| SMILES | O=c1[nH]c2nccc(Nc3cccc(Cl)c3)c2c2occc12 |
| InChI | InChI=1S/C16H10ClN3O2/c17-9-2-1-3-10(8-9)19-12-4-6-18-15-13(12)14-11(5-7-22-14)16(21)20-15/h1-8H,(H2,18,19,20,21) |
| InChIKey | XGAUPBFYMFAJIS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |