C19H12F3N3O — CID 141243236
1-anilino-9-(trifluoromethyl)-5H-benzo[c][1,8]naphthyridin-6-one (PubChem CID 141243236) has the molecular formula C19H12F3N3O and a molecular weight of 355.32 g/mol. Its IUPAC name is 1-anilino-9-(trifluoromethyl)-5H-benzo[c][1,8]naphthyridin-6-one.
| Compound Name | 1-anilino-9-(trifluoromethyl)-5H-benzo[c][1,8]naphthyridin-6-one |
|---|---|
| PubChem CID | 141243236 |
| Molecular Formula | C19H12F3N3O |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-anilino-9-(trifluoromethyl)-5H-benzo[c][1,8]naphthyridin-6-one |
| SMILES | O=c1[nH]c2nccc(Nc3ccccc3)c2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C19H12F3N3O/c20-19(21,22)11-6-7-13-14(10-11)16-15(24-12-4-2-1-3-5-12)8-9-23-17(16)25-18(13)26/h1-10H,(H2,23,24,25,26) |
| InChIKey | AWDLLFMHEAHIGP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|