C14H13Cl2N4O3S- — CID 170349625
2-oxo-5-[3-(sulfinatoamino)anilino]-1H-1,8-naphthyridine;dihydrochloride (PubChem CID 170349625) has the molecular formula C14H13Cl2N4O3S- and a molecular weight of 388.26 g/mol. Its IUPAC name is 2-oxo-5-[3-(sulfinatoamino)anilino]-1H-1,8-naphthyridine;dihydrochloride.
| Compound Name | 2-oxo-5-[3-(sulfinatoamino)anilino]-1H-1,8-naphthyridine;dihydrochloride |
|---|---|
| PubChem CID | 170349625 |
| Molecular Formula | C14H13Cl2N4O3S- |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 2-oxo-5-[3-(sulfinatoamino)anilino]-1H-1,8-naphthyridine;dihydrochloride |
| SMILES | Cl.Cl.O=c1ccc2c(Nc3cccc(NS(=O)[O-])c3)ccnc2[nH]1 |
| InChI | InChI=1S/C14H12N4O3S.2ClH/c19-13-5-4-11-12(6-7-15-14(11)17-13)16-9-2-1-3-10(8-9)18-22(20)21;;/h1-8,18H,(H,20,21)(H2,15,16,17,19);2*1H/p-1 |
| InChIKey | VOUDYTYSXOCOSG-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|