C15H12ClFN3O3S- — CID 170349595
5-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride (PubChem CID 170349595) has the molecular formula C15H12ClFN3O3S- and a molecular weight of 368.80 g/mol. Its IUPAC name is 5-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride.
| Compound Name | 5-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 170349595 |
| Molecular Formula | C15H12ClFN3O3S- |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 5-[2-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine;hydrochloride |
| SMILES | Cl.O=c1ccc2c(-c3ccc(CNS(=O)[O-])cc3F)ccnc2[nH]1 |
| InChI | InChI=1S/C15H12FN3O3S.ClH/c16-13-7-9(8-18-23(21)22)1-2-11(13)10-5-6-17-15-12(10)3-4-14(20)19-15;/h1-7,18H,8H2,(H,21,22)(H,17,19,20);1H/p-1 |
| InChIKey | XXLSKUMDEKRLRW-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|