C14H10FN3O — CID 171456884
5-(5-amino-2-fluorophenyl)-1H-1,8-naphthyridin-2-one (PubChem CID 171456884) has the molecular formula C14H10FN3O and a molecular weight of 255.25 g/mol. Its IUPAC name is 5-(5-amino-2-fluorophenyl)-1H-1,8-naphthyridin-2-one.
| Compound Name | 5-(5-amino-2-fluorophenyl)-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 171456884 |
| Molecular Formula | C14H10FN3O |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-(5-amino-2-fluorophenyl)-1H-1,8-naphthyridin-2-one |
| SMILES | Nc1ccc(F)c(-c2ccnc3[nH]c(=O)ccc23)c1 |
| InChI | InChI=1S/C14H10FN3O/c15-12-3-1-8(16)7-11(12)9-5-6-17-14-10(9)2-4-13(19)18-14/h1-7H,16H2,(H,17,18,19) |
| InChIKey | ORTSDFMYOXJTJD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|