C15H12F2N4O3S — CID 164563698
5-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine (PubChem CID 164563698) has the molecular formula C15H12F2N4O3S and a molecular weight of 366.35 g/mol. Its IUPAC name is 5-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine.
| Compound Name | 5-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 164563698 |
| Molecular Formula | C15H12F2N4O3S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 5-[2,6-difluoro-4-[(sulfamoylamino)methyl]phenyl]-2-oxo-1H-1,8-naphthyridine |
| SMILES | NS(=O)(=O)NCc1cc(F)c(-c2ccnc3[nH]c(=O)ccc23)c(F)c1 |
| InChI | InChI=1S/C15H12F2N4O3S/c16-11-5-8(7-20-25(18,23)24)6-12(17)14(11)9-3-4-19-15-10(9)1-2-13(22)21-15/h1-6,20H,7H2,(H2,18,23,24)(H,19,21,22) |
| InChIKey | BONMQKAEVLSJCP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |