C18H14FN3O3S — CID 155099918
3-cyano-6-fluoro-7-methoxy-4-[4-[(sulfinoamino)methyl]phenyl]quinoline (PubChem CID 155099918) has the molecular formula C18H14FN3O3S and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-cyano-6-fluoro-7-methoxy-4-[4-[(sulfinoamino)methyl]phenyl]quinoline.
| Compound Name | 3-cyano-6-fluoro-7-methoxy-4-[4-[(sulfinoamino)methyl]phenyl]quinoline |
|---|---|
| PubChem CID | 155099918 |
| Molecular Formula | C18H14FN3O3S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-cyano-6-fluoro-7-methoxy-4-[4-[(sulfinoamino)methyl]phenyl]quinoline |
| SMILES | COc1cc2ncc(C#N)c(-c3ccc(CNS(=O)O)cc3)c2cc1F |
| InChI | InChI=1S/C18H14FN3O3S/c1-25-17-7-16-14(6-15(17)19)18(13(8-20)10-21-16)12-4-2-11(3-5-12)9-22-26(23)24/h2-7,10,22H,9H2,1H3,(H,23,24) |
| InChIKey | BJELBQVQQIQMTJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|