C18H17N5O4S — CID 166703667
3-cyano-6,7-dimethoxy-4-[6-[(sulfamoylamino)methyl]-3-pyridinyl]quinoline (PubChem CID 166703667) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is 3-cyano-6,7-dimethoxy-4-[6-[(sulfamoylamino)methyl]-3-pyridinyl]quinoline.
| Compound Name | 3-cyano-6,7-dimethoxy-4-[6-[(sulfamoylamino)methyl]-3-pyridinyl]quinoline |
|---|---|
| PubChem CID | 166703667 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 3-cyano-6,7-dimethoxy-4-[6-[(sulfamoylamino)methyl]-3-pyridinyl]quinoline |
| SMILES | COc1cc2ncc(C#N)c(-c3ccc(CNS(N)(=O)=O)nc3)c2cc1OC |
| InChI | InChI=1S/C18H17N5O4S/c1-26-16-5-14-15(6-17(16)27-2)22-9-12(7-19)18(14)11-3-4-13(21-8-11)10-23-28(20,24)25/h3-6,8-9,23H,10H2,1-2H3,(H2,20,24,25) |
| InChIKey | SSZKRZBRXUKZOW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |