C16H20N4O2 — CID 156824049
4-(4-aminobutylamino)-6,7-dimethoxyquinoline-3-carbonitrile (PubChem CID 156824049) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-(4-aminobutylamino)-6,7-dimethoxyquinoline-3-carbonitrile.
| Compound Name | 4-(4-aminobutylamino)-6,7-dimethoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 156824049 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-(4-aminobutylamino)-6,7-dimethoxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(NCCCCN)c2cc1OC |
| InChI | InChI=1S/C16H20N4O2/c1-21-14-7-12-13(8-15(14)22-2)20-10-11(9-18)16(12)19-6-4-3-5-17/h7-8,10H,3-6,17H2,1-2H3,(H,19,20) |
| InChIKey | CJXXKTIREPWFMC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|