C16H19N5O6S — CID 166693177
3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoylcarbamic acid (PubChem CID 166693177) has the molecular formula C16H19N5O6S and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoylcarbamic acid.
| Compound Name | 3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoylcarbamic acid |
|---|---|
| PubChem CID | 166693177 |
| Molecular Formula | C16H19N5O6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoylcarbamic acid |
| SMILES | COc1cc2ncc(C#N)c(NCCCNS(=O)(=O)NC(=O)O)c2cc1OC |
| InChI | InChI=1S/C16H19N5O6S/c1-26-13-6-11-12(7-14(13)27-2)19-9-10(8-17)15(11)18-4-3-5-20-28(24,25)21-16(22)23/h6-7,9,20-21H,3-5H2,1-2H3,(H,18,19)(H,22,23) |
| InChIKey | KPJHJXSYBYGPGN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|