C22H30N4O6S2 — CID 156824072
tert-butyl N-[5-(3-cyano-6,7-dimethoxyquinolin-4-yl)sulfanylpentylsulfamoyl]carbamate (PubChem CID 156824072) has the molecular formula C22H30N4O6S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is tert-butyl N-[5-(3-cyano-6,7-dimethoxyquinolin-4-yl)sulfanylpentylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[5-(3-cyano-6,7-dimethoxyquinolin-4-yl)sulfanylpentylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 156824072 |
| Molecular Formula | C22H30N4O6S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | tert-butyl N-[5-(3-cyano-6,7-dimethoxyquinolin-4-yl)sulfanylpentylsulfamoyl]carbamate |
| SMILES | COc1cc2ncc(C#N)c(SCCCCCNS(=O)(=O)NC(=O)OC(C)(C)C)c2cc1OC |
| InChI | InChI=1S/C22H30N4O6S2/c1-22(2,3)32-21(27)26-34(28,29)25-9-7-6-8-10-33-20-15(13-23)14-24-17-12-19(31-5)18(30-4)11-16(17)20/h11-12,14,25H,6-10H2,1-5H3,(H,26,27) |
| InChIKey | ATUGHYYGHHMMPZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|