C18H23N5O6S — CID 175452445
5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl carbamate (PubChem CID 175452445) has the molecular formula C18H23N5O6S and a molecular weight of 437.48 g/mol. Its IUPAC name is 5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl carbamate.
| Compound Name | 5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl carbamate |
|---|---|
| PubChem CID | 175452445 |
| Molecular Formula | C18H23N5O6S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl carbamate |
| SMILES | COc1cc2ncc(C#N)c(NCCCCCNS(=O)(=O)OC(N)=O)c2cc1OC |
| InChI | InChI=1S/C18H23N5O6S/c1-27-15-8-13-14(9-16(15)28-2)22-11-12(10-19)17(13)21-6-4-3-5-7-23-30(25,26)29-18(20)24/h8-9,11,23H,3-7H2,1-2H3,(H2,20,24)(H,21,22) |
| InChIKey | BJJGJDPTWKOHJB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|