C16H19N5O6S — CID 175452464
3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoyl carbamate (PubChem CID 175452464) has the molecular formula C16H19N5O6S and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoyl carbamate.
| Compound Name | 3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoyl carbamate |
|---|---|
| PubChem CID | 175452464 |
| Molecular Formula | C16H19N5O6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 3-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]propylsulfamoyl carbamate |
| SMILES | COc1cc2ncc(C#N)c(NCCCNS(=O)(=O)OC(N)=O)c2cc1OC |
| InChI | InChI=1S/C16H19N5O6S/c1-25-13-6-11-12(7-14(13)26-2)20-9-10(8-17)15(11)19-4-3-5-21-28(23,24)27-16(18)22/h6-7,9,21H,3-5H2,1-2H3,(H2,18,22)(H,19,20) |
| InChIKey | PGILMEVYVYNBNV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|