C22H31N5O6S — CID 166071311
tert-butyl-[5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl]carbamic acid (PubChem CID 166071311) has the molecular formula C22H31N5O6S and a molecular weight of 493.59 g/mol. Its IUPAC name is tert-butyl-[5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl]carbamic acid.
| Compound Name | tert-butyl-[5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl]carbamic acid |
|---|---|
| PubChem CID | 166071311 |
| Molecular Formula | C22H31N5O6S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | tert-butyl-[5-[(3-cyano-6,7-dimethoxyquinolin-4-yl)amino]pentylsulfamoyl]carbamic acid |
| SMILES | COc1cc2ncc(C#N)c(NCCCCCNS(=O)(=O)N(C(=O)O)C(C)(C)C)c2cc1OC |
| InChI | InChI=1S/C22H31N5O6S/c1-22(2,3)27(21(28)29)34(30,31)26-10-8-6-7-9-24-20-15(13-23)14-25-17-12-19(33-5)18(32-4)11-16(17)20/h11-12,14,26H,6-10H2,1-5H3,(H,24,25)(H,28,29) |
| InChIKey | PNOWIXLDXBANFL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|