C8H14N6O4S — CID 106332353
N-[3-[(6-amino-5-nitropyrimidin-4-yl)amino]propyl]methanesulfonamide (PubChem CID 106332353) has the molecular formula C8H14N6O4S and a molecular weight of 290.31 g/mol. Its IUPAC name is N-[3-[(6-amino-5-nitropyrimidin-4-yl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(6-amino-5-nitropyrimidin-4-yl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332353 |
| Molecular Formula | C8H14N6O4S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[3-[(6-amino-5-nitropyrimidin-4-yl)amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N6O4S/c1-19(17,18)13-4-2-3-10-8-6(14(15)16)7(9)11-5-12-8/h5,13H,2-4H2,1H3,(H3,9,10,11,12) |
| InChIKey | DLNXDDNMQWUVLZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|