C6H10N6O4S — CID 80787351
2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethanesulfonamide (PubChem CID 80787351) has the molecular formula C6H10N6O4S and a molecular weight of 262.25 g/mol. Its IUPAC name is 2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 80787351 |
| Molecular Formula | C6H10N6O4S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-[(6-amino-5-nitropyrimidin-4-yl)amino]ethanesulfonamide |
| SMILES | Nc1ncnc(NCCS(N)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N6O4S/c7-5-4(12(13)14)6(11-3-10-5)9-1-2-17(8,15)16/h3H,1-2H2,(H2,8,15,16)(H3,7,9,10,11) |
| InChIKey | DLKMSIOFBGWQND-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|