C13H23BrN4O2 — CID 80806443
5-bromo-2-N-ethyl-4-N-(2-methoxyethyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine (PubChem CID 80806443) has the molecular formula C13H23BrN4O2 and a molecular weight of 347.26 g/mol. Its IUPAC name is 5-bromo-2-N-ethyl-4-N-(2-methoxyethyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-ethyl-4-N-(2-methoxyethyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80806443 |
| Molecular Formula | C13H23BrN4O2 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 5-bromo-2-N-ethyl-4-N-(2-methoxyethyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Br)c(N(CCCOC)CCOC)n1 |
| InChI | InChI=1S/C13H23BrN4O2/c1-4-15-13-16-10-11(14)12(17-13)18(7-9-20-3)6-5-8-19-2/h10H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | VUMZYGLOBMSFSC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|