C16H21N3 — CID 116546128
N,4,5-trimethyl-6-(3-propylphenyl)pyridazin-3-amine (PubChem CID 116546128) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is N,4,5-trimethyl-6-(3-propylphenyl)pyridazin-3-amine.
| Compound Name | N,4,5-trimethyl-6-(3-propylphenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 116546128 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N,4,5-trimethyl-6-(3-propylphenyl)pyridazin-3-amine |
| SMILES | CCCc1cccc(-c2nnc(NC)c(C)c2C)c1 |
| InChI | InChI=1S/C16H21N3/c1-5-7-13-8-6-9-14(10-13)15-11(2)12(3)16(17-4)19-18-15/h6,8-10H,5,7H2,1-4H3,(H,17,19) |
| InChIKey | LXCWLRJTZVLIEQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |