C18H23N3 — CID 114607011
6-(3-cyclobutylphenyl)-N-ethyl-4,5-dimethylpyridazin-3-amine (PubChem CID 114607011) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 6-(3-cyclobutylphenyl)-N-ethyl-4,5-dimethylpyridazin-3-amine.
| Compound Name | 6-(3-cyclobutylphenyl)-N-ethyl-4,5-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 114607011 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 6-(3-cyclobutylphenyl)-N-ethyl-4,5-dimethylpyridazin-3-amine |
| SMILES | CCNc1nnc(-c2cccc(C3CCC3)c2)c(C)c1C |
| InChI | InChI=1S/C18H23N3/c1-4-19-18-13(3)12(2)17(20-21-18)16-10-6-9-15(11-16)14-7-5-8-14/h6,9-11,14H,4-5,7-8H2,1-3H3,(H,19,21) |
| InChIKey | AHLGNRLRYDABDR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |