About 4-butyl-2,3,5,6-tetrachloropyridine
4-butyl-2,3,5,6-tetrachloropyridine (PubChem CID 71357980) has the molecular formula C9H9Cl4N
and a molecular weight of 272.99 g/mol. Its IUPAC name is 4-butyl-2,3,5,6-tetrachloropyridine.
Molecular Properties
| Compound Name | 4-butyl-2,3,5,6-tetrachloropyridine |
| PubChem CID | 71357980 |
| Molecular Formula | C9H9Cl4N |
| Molecular Weight | 272.99 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 4-butyl-2,3,5,6-tetrachloropyridine |
| SMILES | CCCCc1c(Cl)c(Cl)nc(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl4N/c1-2-3-4-5-6(10)8(12)14-9(13)7(5)11/h2-4H2,1H3 |
| InChIKey | JYPSGYZTBIAHIY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-2,3,5,6-tetrachloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2,3,5,6-tetrachloropyridine?
The IUPAC name of 4-butyl-2,3,5,6-tetrachloropyridine (CID 71357980) is 4-butyl-2,3,5,6-tetrachloropyridine.
What is the SMILES notation for 4-butyl-2,3,5,6-tetrachloropyridine?
The canonical SMILES for 4-butyl-2,3,5,6-tetrachloropyridine is CCCCc1c(Cl)c(Cl)nc(Cl)c1Cl.
What is the InChIKey of 4-butyl-2,3,5,6-tetrachloropyridine?
The InChIKey is JYPSGYZTBIAHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl4N/c1-2-3-4-5-6(10)8(12)14-9(13)7(5)11/h2-4H2,1H3.
What are the key properties of 4-butyl-2,3,5,6-tetrachloropyridine?
4-butyl-2,3,5,6-tetrachloropyridine has a molecular weight of 272.99 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2,3,5,6-tetrachloropyridine is sourced from PubChem (CID 71357980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).