C14H14Cl2N2O3S — CID 171535563
2-(3,6-dichloro-5-methylpyridazin-4-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 171535563) has the molecular formula C14H14Cl2N2O3S and a molecular weight of 361.25 g/mol. Its IUPAC name is 2-(3,6-dichloro-5-methylpyridazin-4-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(3,6-dichloro-5-methylpyridazin-4-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171535563 |
| Molecular Formula | C14H14Cl2N2O3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-(3,6-dichloro-5-methylpyridazin-4-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2c(Cl)nnc(Cl)c2C)cc1 |
| InChI | InChI=1S/C14H14Cl2N2O3S/c1-9-3-5-11(6-4-9)22(19,20)21-8-7-12-10(2)13(15)17-18-14(12)16/h3-6H,7-8H2,1-2H3 |
| InChIKey | VWLMCCMJGNHYQN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|