C16H20ClNO4S — CID 142690277
2-(2-tert-butyl-5-chloro-1,3-oxazol-4-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 142690277) has the molecular formula C16H20ClNO4S and a molecular weight of 357.86 g/mol. Its IUPAC name is 2-(2-tert-butyl-5-chloro-1,3-oxazol-4-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2-tert-butyl-5-chloro-1,3-oxazol-4-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 142690277 |
| Molecular Formula | C16H20ClNO4S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-(2-tert-butyl-5-chloro-1,3-oxazol-4-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2nc(C(C)(C)C)oc2Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO4S/c1-11-5-7-12(8-6-11)23(19,20)21-10-9-13-14(17)22-15(18-13)16(2,3)4/h5-8H,9-10H2,1-4H3 |
| InChIKey | CHRXBEQHVRNRCV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|