C12H14N2O3S — CID 139915720
2-(1H-pyrazol-5-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 139915720) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(1H-pyrazol-5-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139915720 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(1H-pyrazol-5-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccn[nH]2)cc1 |
| InChI | InChI=1S/C12H14N2O3S/c1-10-2-4-12(5-3-10)18(15,16)17-9-7-11-6-8-13-14-11/h2-6,8H,7,9H2,1H3,(H,13,14) |
| InChIKey | UDKYROZHTKPEQS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|