C10H15N5 — CID 57350721
3-butyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 57350721) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-butyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-butyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 57350721 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-butyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCc1nn(C)c2ncnc(N)c12 |
| InChI | InChI=1S/C10H15N5/c1-3-4-5-7-8-9(11)12-6-13-10(8)15(2)14-7/h6H,3-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | IRCDZZVXFUBIIK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |