C16H23BN5S — CID 159575581
CID 159575581 (PubChem CID 159575581) has the molecular formula C16H23BN5S and a molecular weight of 328.27 g/mol.
| Compound Name | CID 159575581 |
|---|---|
| PubChem CID | 159575581 |
| Molecular Formula | C16H23BN5S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | — |
| SMILES | CC.CC.Cn1nc(Sc2ccccc2)c2c(N)ncnc21.[B] |
| InChI | InChI=1S/C12H11N5S.2C2H6.B/c1-17-11-9(10(13)14-7-15-11)12(16-17)18-8-5-3-2-4-6-8;2*1-2;/h2-7H,1H3,(H2,13,14,15);2*1-2H3; |
| InChIKey | LKBXSBXBYBSKLG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|