C16H17N5 — CID 91235697
ethane;9-methyl-8-(2-phenylethynyl)purin-6-amine (PubChem CID 91235697) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is ethane;9-methyl-8-(2-phenylethynyl)purin-6-amine.
| Compound Name | ethane;9-methyl-8-(2-phenylethynyl)purin-6-amine |
|---|---|
| PubChem CID | 91235697 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | ethane;9-methyl-8-(2-phenylethynyl)purin-6-amine |
| SMILES | CC.Cn1c(C#Cc2ccccc2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C14H11N5.C2H6/c1-19-11(8-7-10-5-3-2-4-6-10)18-12-13(15)16-9-17-14(12)19;1-2/h2-6,9H,1H3,(H2,15,16,17);1-2H3 |
| InChIKey | QHALXTJNCVBEGR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|