C22H19N7O3 — CID 23584457
(2R,3S,5R)-5-[6-amino-8-[2-(6-pyridin-2-yl-3-pyridinyl)ethynyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 23584457) has the molecular formula C22H19N7O3 and a molecular weight of 429.44 g/mol. Its IUPAC name is (2R,3S,5R)-5-[6-amino-8-[2-(6-pyridin-2-yl-3-pyridinyl)ethynyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[6-amino-8-[2-(6-pyridin-2-yl-3-pyridinyl)ethynyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 23584457 |
| Molecular Formula | C22H19N7O3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (2R,3S,5R)-5-[6-amino-8-[2-(6-pyridin-2-yl-3-pyridinyl)ethynyl]purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1nc(C#Cc1ccc(-c3ccccn3)nc1)n2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C22H19N7O3/c23-21-20-22(27-12-26-21)29(19-9-16(31)17(11-30)32-19)18(28-20)7-5-13-4-6-15(25-10-13)14-3-1-2-8-24-14/h1-4,6,8,10,12,16-17,19,30-31H,9,11H2,(H2,23,26,27)/t16-,17+,19+/m0/s1 |
| InChIKey | PKADJWXADHJPBM-YQVWRLOYSA-N |
| XLogP | 0.91 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|