C18H12N18 — CID 102192385
9-[4,6-bis(6-aminopurin-9-yl)-1,3,5-triazin-2-yl]purin-6-amine (PubChem CID 102192385) has the molecular formula C18H12N18 and a molecular weight of 480.42 g/mol. Its IUPAC name is 9-[4,6-bis(6-aminopurin-9-yl)-1,3,5-triazin-2-yl]purin-6-amine.
| Compound Name | 9-[4,6-bis(6-aminopurin-9-yl)-1,3,5-triazin-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 102192385 |
| Molecular Formula | C18H12N18 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 9-[4,6-bis(6-aminopurin-9-yl)-1,3,5-triazin-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2-c1nc(-n2cnc3c(N)ncnc32)nc(-n2cnc3c(N)ncnc32)n1 |
| InChI | InChI=1S/C18H12N18/c19-10-7-13(25-1-22-10)34(4-28-7)16-31-17(35-5-29-8-11(20)23-2-26-14(8)35)33-18(32-16)36-6-30-9-12(21)24-3-27-15(9)36/h1-6H,(H2,19,22,25)(H2,20,23,26)(H2,21,24,27) |
| InChIKey | OZQQXMRUOGDXHE-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 247.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |