C17H29N5 — CID 143869511
ethane;9-(4,5,5-trimethylcyclopenten-1-yl)purin-6-amine (PubChem CID 143869511) has the molecular formula C17H29N5 and a molecular weight of 303.45 g/mol. Its IUPAC name is ethane;9-(4,5,5-trimethylcyclopenten-1-yl)purin-6-amine.
| Compound Name | ethane;9-(4,5,5-trimethylcyclopenten-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 143869511 |
| Molecular Formula | C17H29N5 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | ethane;9-(4,5,5-trimethylcyclopenten-1-yl)purin-6-amine |
| SMILES | CC.CC.CC1CC=C(n2cnc3c(N)ncnc32)C1(C)C |
| InChI | InChI=1S/C13H17N5.2C2H6/c1-8-4-5-9(13(8,2)3)18-7-17-10-11(14)15-6-16-12(10)18;2*1-2/h5-8H,4H2,1-3H3,(H2,14,15,16);2*1-2H3 |
| InChIKey | TWQUCRCJPZCUIN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |