C10H11N5O3 — CID 11253697
(1R,2R,3S)-4-(6-aminopurin-9-yl)cyclopent-4-ene-1,2,3-triol (PubChem CID 11253697) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is (1R,2R,3S)-4-(6-aminopurin-9-yl)cyclopent-4-ene-1,2,3-triol.
| Compound Name | (1R,2R,3S)-4-(6-aminopurin-9-yl)cyclopent-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 11253697 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (1R,2R,3S)-4-(6-aminopurin-9-yl)cyclopent-4-ene-1,2,3-triol |
| SMILES | Nc1ncnc2c1ncn2C1=C[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H11N5O3/c11-9-6-10(13-2-12-9)15(3-14-6)4-1-5(16)8(18)7(4)17/h1-3,5,7-8,16-18H,(H2,11,12,13)/t5-,7+,8-/m1/s1 |
| InChIKey | KMEKAGAOVOIXLV-MHSYXAOVSA-N |
| XLogP | -1.65 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |