C19H25N5 — CID 59633547
1-tert-butyl-3-(4-butylphenyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 59633547) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-tert-butyl-3-(4-butylphenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-tert-butyl-3-(4-butylphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59633547 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1-tert-butyl-3-(4-butylphenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCc1ccc(-c2nn(C(C)(C)C)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C19H25N5/c1-5-6-7-13-8-10-14(11-9-13)16-15-17(20)21-12-22-18(15)24(23-16)19(2,3)4/h8-12H,5-7H2,1-4H3,(H2,20,21,22) |
| InChIKey | MPTFPMFDAQXSQJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |