1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid

C8H9F3N2O3 — CID 154037045

IUPAC1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid
SMILESCc1c(C(=O)O)nn(C)c1OCC(F)(F)F
InChIInChI=1S/C8H9F3N2O3/c1-4-5(7(14)15)12-13(2)6(4)16-3-8(9,10)11/h3H2,1-2H3,(H,14,15)
InChIKeyOWHQROIAAPSGLS-UHFFFAOYSA-N
MW238.16 g/mol
LogP1.37
Rot. Bonds3

About 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid

1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid (PubChem CID 154037045) has the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. Its IUPAC name is 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid
PubChem CID154037045
Molecular FormulaC8H9F3N2O3
Molecular Weight238.16 g/mol
Exact Mass238.06
IUPAC Name1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid
SMILESCc1c(C(=O)O)nn(C)c1OCC(F)(F)F
InChIInChI=1S/C8H9F3N2O3/c1-4-5(7(14)15)12-13(2)6(4)16-3-8(9,10)11/h3H2,1-2H3,(H,14,15)
InChIKeyOWHQROIAAPSGLS-UHFFFAOYSA-N
XLogP1.37
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.16
LogP ≤ 51.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid?
The IUPAC name of 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid (CID 154037045) is 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid.
What is the SMILES notation for 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid?
The canonical SMILES for 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid is Cc1c(C(=O)O)nn(C)c1OCC(F)(F)F.
What is the InChIKey of 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid?
The InChIKey is OWHQROIAAPSGLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O3/c1-4-5(7(14)15)12-13(2)6(4)16-3-8(9,10)11/h3H2,1-2H3,(H,14,15).
What are the key properties of 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid?
1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid has a molecular weight of 238.16 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid is sourced from PubChem (CID 154037045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).