C9H12F3N3O2 — CID 81339753
1,3,5-trimethyl-N-(2,2,2-trifluoroethoxy)pyrazole-4-carboxamide (PubChem CID 81339753) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-(2,2,2-trifluoroethoxy)pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-(2,2,2-trifluoroethoxy)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 81339753 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1,3,5-trimethyl-N-(2,2,2-trifluoroethoxy)pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O2/c1-5-7(6(2)15(3)13-5)8(16)14-17-4-9(10,11)12/h4H2,1-3H3,(H,14,16) |
| InChIKey | LZBKKHYQJFFRPR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|