C7H6F3IN2O3 — CID 58542565
4-iodo-1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid (PubChem CID 58542565) has the molecular formula C7H6F3IN2O3 and a molecular weight of 350.03 g/mol. Its IUPAC name is 4-iodo-1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid.
| Compound Name | 4-iodo-1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 58542565 |
| Molecular Formula | C7H6F3IN2O3 |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 4-iodo-1-methyl-3-(2,2,2-trifluoroethoxy)pyrazole-5-carboxylic acid |
| SMILES | Cn1nc(OCC(F)(F)F)c(I)c1C(=O)O |
| InChI | InChI=1S/C7H6F3IN2O3/c1-13-4(6(14)15)3(11)5(12-13)16-2-7(8,9)10/h2H2,1H3,(H,14,15) |
| InChIKey | YCOUBZSNLYCBIM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|