C8H4F5N3O2 — CID 75406330
4-cyano-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid (PubChem CID 75406330) has the molecular formula C8H4F5N3O2 and a molecular weight of 269.13 g/mol. Its IUPAC name is 4-cyano-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid.
| Compound Name | 4-cyano-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 75406330 |
| Molecular Formula | C8H4F5N3O2 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 4-cyano-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-5-carboxylic acid |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C#N)c1C(=O)O |
| InChI | InChI=1S/C8H4F5N3O2/c1-16-4(6(17)18)3(2-14)5(15-16)7(9,10)8(11,12)13/h1H3,(H,17,18) |
| InChIKey | WFDCGIHXIPMNAH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|