C7H6F5IN2O3 — CID 87377838
carbonic acid;4-iodo-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole (PubChem CID 87377838) has the molecular formula C7H6F5IN2O3 and a molecular weight of 388.03 g/mol. Its IUPAC name is carbonic acid;4-iodo-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole.
| Compound Name | carbonic acid;4-iodo-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole |
|---|---|
| PubChem CID | 87377838 |
| Molecular Formula | C7H6F5IN2O3 |
| Molecular Weight | 388.03 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | carbonic acid;4-iodo-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole |
| SMILES | Cn1cc(I)c(C(F)(F)C(F)(F)F)n1.O=C(O)O |
| InChI | InChI=1S/C6H4F5IN2.CH2O3/c1-14-2-3(12)4(13-14)5(7,8)6(9,10)11;2-1(3)4/h2H,1H3;(H2,2,3,4) |
| InChIKey | CKUVBDQPXOINHY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.03 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|