C18H19F5IN3O2 — CID 86656113
tert-butyl N-[4-[[4-iodo-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylphenyl]carbamate (PubChem CID 86656113) has the molecular formula C18H19F5IN3O2 and a molecular weight of 531.26 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-iodo-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-iodo-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 86656113 |
| Molecular Formula | C18H19F5IN3O2 |
| Molecular Weight | 531.26 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | tert-butyl N-[4-[[4-iodo-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-2-methylphenyl]carbamate |
| SMILES | Cc1cc(Cn2cc(I)c(C(F)(F)C(F)(F)F)n2)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H19F5IN3O2/c1-10-7-11(5-6-13(10)25-15(28)29-16(2,3)4)8-27-9-12(24)14(26-27)17(19,20)18(21,22)23/h5-7,9H,8H2,1-4H3,(H,25,28) |
| InChIKey | XPZSSEOXRDYBOS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|