C8H10F3IN2O — CID 122171905
4-iodo-1-methyl-3-(3,3,3-trifluoropropoxymethyl)pyrazole (PubChem CID 122171905) has the molecular formula C8H10F3IN2O and a molecular weight of 334.08 g/mol. Its IUPAC name is 4-iodo-1-methyl-3-(3,3,3-trifluoropropoxymethyl)pyrazole.
| Compound Name | 4-iodo-1-methyl-3-(3,3,3-trifluoropropoxymethyl)pyrazole |
|---|---|
| PubChem CID | 122171905 |
| Molecular Formula | C8H10F3IN2O |
| Molecular Weight | 334.08 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 4-iodo-1-methyl-3-(3,3,3-trifluoropropoxymethyl)pyrazole |
| SMILES | Cn1cc(I)c(COCCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3IN2O/c1-14-4-6(12)7(13-14)5-15-3-2-8(9,10)11/h4H,2-3,5H2,1H3 |
| InChIKey | AJZSGSULDAFMMO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.08 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|