C8H9BrF3IN2O — CID 79784992
4-bromo-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole (PubChem CID 79784992) has the molecular formula C8H9BrF3IN2O and a molecular weight of 412.98 g/mol. Its IUPAC name is 4-bromo-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole.
| Compound Name | 4-bromo-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole |
|---|---|
| PubChem CID | 79784992 |
| Molecular Formula | C8H9BrF3IN2O |
| Molecular Weight | 412.98 g/mol |
| Exact Mass | 411.89 |
| IUPAC Name | 4-bromo-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole |
| SMILES | FC(F)(F)COCCCn1cc(Br)c(I)n1 |
| InChI | InChI=1S/C8H9BrF3IN2O/c9-6-4-15(14-7(6)13)2-1-3-16-5-8(10,11)12/h4H,1-3,5H2 |
| InChIKey | NMCJIEHXFUCOHU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|