C9H12ClF3N2O — CID 106720831
4-(chloromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole (PubChem CID 106720831) has the molecular formula C9H12ClF3N2O and a molecular weight of 256.65 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole.
| Compound Name | 4-(chloromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole |
|---|---|
| PubChem CID | 106720831 |
| Molecular Formula | C9H12ClF3N2O |
| Molecular Weight | 256.65 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-(chloromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole |
| SMILES | FC(F)(F)COCCCn1cnc(CCl)c1 |
| InChI | InChI=1S/C9H12ClF3N2O/c10-4-8-5-15(7-14-8)2-1-3-16-6-9(11,12)13/h5,7H,1-4,6H2 |
| InChIKey | CGGPXUUJXIOJNV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.65 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|