C9H11F3N2O2 — CID 106716641
1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-carbaldehyde (PubChem CID 106716641) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-carbaldehyde.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 106716641 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-carbaldehyde |
| SMILES | O=Cc1cn(CCCOCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H11F3N2O2/c10-9(11,12)6-16-3-1-2-14-4-8(5-15)13-7-14/h4-5,7H,1-3,6H2 |
| InChIKey | XMHOEQJXWXJFKS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|