C15H28N2O — CID 114201866
4,6-dimethyl-1-(1,3,5-trimethylpyrazol-4-yl)heptan-2-ol (PubChem CID 114201866) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 4,6-dimethyl-1-(1,3,5-trimethylpyrazol-4-yl)heptan-2-ol.
| Compound Name | 4,6-dimethyl-1-(1,3,5-trimethylpyrazol-4-yl)heptan-2-ol |
|---|---|
| PubChem CID | 114201866 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 4,6-dimethyl-1-(1,3,5-trimethylpyrazol-4-yl)heptan-2-ol |
| SMILES | Cc1nn(C)c(C)c1CC(O)CC(C)CC(C)C |
| InChI | InChI=1S/C15H28N2O/c1-10(2)7-11(3)8-14(18)9-15-12(4)16-17(6)13(15)5/h10-11,14,18H,7-9H2,1-6H3 |
| InChIKey | BYHUSWXHXYRFMZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |