C15H26ClN5 — CID 105265889
[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine (PubChem CID 105265889) has the molecular formula C15H26ClN5 and a molecular weight of 311.86 g/mol. Its IUPAC name is [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265889 |
| Molecular Formula | C15H26ClN5 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
| SMILES | Cc1nn(C)c(CC(NN)C2CC3CCC(C2)N3C)c1Cl |
| InChI | InChI=1S/C15H26ClN5/c1-9-15(16)14(21(3)19-9)8-13(18-17)10-6-11-4-5-12(7-10)20(11)2/h10-13,18H,4-8,17H2,1-3H3 |
| InChIKey | ADWPKYFPEHPFAG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|