About 1-(thian-3-yl)butan-1-ol
1-(thian-3-yl)butan-1-ol (PubChem CID 130518370) has the molecular formula C9H18OS
and a molecular weight of 174.31 g/mol. Its IUPAC name is 1-(thian-3-yl)butan-1-ol.
Molecular Properties
| Compound Name | 1-(thian-3-yl)butan-1-ol |
| PubChem CID | 130518370 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 1-(thian-3-yl)butan-1-ol |
| SMILES | CCCC(O)C1CCCSC1 |
| InChI | InChI=1S/C9H18OS/c1-2-4-9(10)8-5-3-6-11-7-8/h8-10H,2-7H2,1H3 |
| InChIKey | JAHJSEMRNZGHAC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(thian-3-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(thian-3-yl)butan-1-ol?
The IUPAC name of 1-(thian-3-yl)butan-1-ol (CID 130518370) is 1-(thian-3-yl)butan-1-ol.
What is the SMILES notation for 1-(thian-3-yl)butan-1-ol?
The canonical SMILES for 1-(thian-3-yl)butan-1-ol is CCCC(O)C1CCCSC1.
What is the InChIKey of 1-(thian-3-yl)butan-1-ol?
The InChIKey is JAHJSEMRNZGHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18OS/c1-2-4-9(10)8-5-3-6-11-7-8/h8-10H,2-7H2,1H3.
What are the key properties of 1-(thian-3-yl)butan-1-ol?
1-(thian-3-yl)butan-1-ol has a molecular weight of 174.31 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(thian-3-yl)butan-1-ol is sourced from PubChem (CID 130518370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).