C15H23NO2S — CID 105144795
2-(1,1-dioxothiolan-3-yl)-1-(4-propan-2-ylphenyl)ethanamine (PubChem CID 105144795) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(4-propan-2-ylphenyl)ethanamine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(4-propan-2-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 105144795 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(4-propan-2-ylphenyl)ethanamine |
| SMILES | CC(C)c1ccc(C(N)CC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-11(2)13-3-5-14(6-4-13)15(16)9-12-7-8-19(17,18)10-12/h3-6,11-12,15H,7-10,16H2,1-2H3 |
| InChIKey | UVIRQYSUCKQOMA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |